About (2-methylcyclopenta-2,4-dien-1-ylidene)methanol
(2-methylcyclopenta-2,4-dien-1-ylidene)methanol (PubChem CID 131740907) has the molecular formula C7H8O
and a molecular weight of 108.14 g/mol. Its IUPAC name is (2-methylcyclopenta-2,4-dien-1-ylidene)methanol.
Molecular Properties
| Compound Name | (2-methylcyclopenta-2,4-dien-1-ylidene)methanol |
| PubChem CID | 131740907 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | (2-methylcyclopenta-2,4-dien-1-ylidene)methanol |
| SMILES | CC1=CC=CC1=CO |
| InChI | InChI=1S/C7H8O/c1-6-3-2-4-7(6)5-8/h2-5,8H,1H3 |
| InChIKey | UBRQVSDZEXMCTQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (2-methylcyclopenta-2,4-dien-1-ylidene)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclopenta-2,4-dien-1-ylidene)methanol?
The IUPAC name of (2-methylcyclopenta-2,4-dien-1-ylidene)methanol (CID 131740907) is (2-methylcyclopenta-2,4-dien-1-ylidene)methanol.
What is the SMILES notation for (2-methylcyclopenta-2,4-dien-1-ylidene)methanol?
The canonical SMILES for (2-methylcyclopenta-2,4-dien-1-ylidene)methanol is CC1=CC=CC1=CO.
What is the InChIKey of (2-methylcyclopenta-2,4-dien-1-ylidene)methanol?
The InChIKey is UBRQVSDZEXMCTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O/c1-6-3-2-4-7(6)5-8/h2-5,8H,1H3.
What are the key properties of (2-methylcyclopenta-2,4-dien-1-ylidene)methanol?
(2-methylcyclopenta-2,4-dien-1-ylidene)methanol has a molecular weight of 108.14 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclopenta-2,4-dien-1-ylidene)methanol is sourced from PubChem (CID 131740907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).