C36H36N6O4S — CID 131741753
1-benzyl-N-[5-[4-[3-(dimethylamino)propoxy]phenyl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide (PubChem CID 131741753) has the molecular formula C36H36N6O4S and a molecular weight of 648.79 g/mol. Its IUPAC name is 1-benzyl-N-[5-[4-[3-(dimethylamino)propoxy]phenyl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[5-[4-[3-(dimethylamino)propoxy]phenyl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 131741753 |
| Molecular Formula | C36H36N6O4S |
| Molecular Weight | 648.79 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | 1-benzyl-N-[5-[4-[3-(dimethylamino)propoxy]phenyl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(NC(=O)c3cnn(Cc4ccccc4)c3)c3cc(-c4ccc(OCCCN(C)C)cc4)cnc32)cc1 |
| InChI | InChI=1S/C36H36N6O4S/c1-26-10-16-32(17-11-26)47(44,45)42-25-34(39-36(43)30-22-38-41(24-30)23-27-8-5-4-6-9-27)33-20-29(21-37-35(33)42)28-12-14-31(15-13-28)46-19-7-18-40(2)3/h4-6,8-17,20-22,24-25H,7,18-19,23H2,1-3H3,(H,39,43) |
| InChIKey | XFPUFBHANVVZFG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.79 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|