C20H37F3N4O4Si — CID 131742073
tert-butyl (4R)-4-[(1R,2S)-2-(azidomethyl)-1-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 131742073) has the molecular formula C20H37F3N4O4Si and a molecular weight of 482.62 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1R,2S)-2-(azidomethyl)-1-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1R,2S)-2-(azidomethyl)-1-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 131742073 |
| Molecular Formula | C20H37F3N4O4Si |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | tert-butyl (4R)-4-[(1R,2S)-2-(azidomethyl)-1-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](CN=[N+]=[N-])C(F)(F)F)COC1(C)C |
| InChI | InChI=1S/C20H37F3N4O4Si/c1-17(2,3)30-16(28)27-14(12-29-19(27,7)8)15(31-32(9,10)18(4,5)6)13(11-25-26-24)20(21,22)23/h13-15H,11-12H2,1-10H3/t13-,14+,15+/m0/s1 |
| InChIKey | AJFMWJRZGKBYIK-RRFJBIMHSA-N |
| XLogP | 6.24 |
| TPSA | 96.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|