About 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid
1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid (PubChem CID 131742180) has the molecular formula C21H24N2O4
and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid |
| PubChem CID | 131742180 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid |
| SMILES | CCN1CC=C(c2ccc(-c3cc(O)c(C(=O)O)c(=O)n3CC)cc2)CC1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-22-11-9-15(10-12-22)14-5-7-16(8-6-14)17-13-18(24)19(21(26)27)20(25)23(17)4-2/h5-9,13,24H,3-4,10-12H2,1-2H3,(H,26,27) |
| InChIKey | KTXXXZGHIANSQL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid?
The IUPAC name of 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid (CID 131742180) is 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid.
What is the SMILES notation for 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid?
The canonical SMILES for 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid is CCN1CC=C(c2ccc(-c3cc(O)c(C(=O)O)c(=O)n3CC)cc2)CC1.
What is the InChIKey of 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid?
The InChIKey is KTXXXZGHIANSQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O4/c1-3-22-11-9-15(10-12-22)14-5-7-16(8-6-14)17-13-18(24)19(21(26)27)20(25)23(17)4-2/h5-9,13,24H,3-4,10-12H2,1-2H3,(H,26,27).
What are the key properties of 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid?
1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid has a molecular weight of 368.43 g/mol, XLogP of 3.05, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6-[4-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-4-hydroxy-2-oxopyridine-3-carboxylic acid is sourced from PubChem (CID 131742180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).