C6H16F2N2O5S2 — CID 131742279
bis(fluorosulfonyl)azanide;ethyl-(2-hydroxyethyl)-dimethylazanium (PubChem CID 131742279) has the molecular formula C6H16F2N2O5S2 and a molecular weight of 298.33 g/mol. Its IUPAC name is bis(fluorosulfonyl)azanide;ethyl-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | bis(fluorosulfonyl)azanide;ethyl-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 131742279 |
| Molecular Formula | C6H16F2N2O5S2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | bis(fluorosulfonyl)azanide;ethyl-(2-hydroxyethyl)-dimethylazanium |
| SMILES | CC[N+](C)(C)CCO.O=S(=O)(F)[N-]S(=O)(=O)F |
| InChI | InChI=1S/C6H16NO.F2NO4S2/c1-4-7(2,3)5-6-8;1-8(4,5)3-9(2,6)7/h8H,4-6H2,1-3H3;/q+1;-1 |
| InChIKey | VLLWJRVMQPTKSE-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 102.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|