C28H36FN5O5Si — CID 131742370
N-[1-(3-fluoro-4-pyrrol-1-ylphenyl)-2-methoxyethyl]-7-methoxy-2-oxo-1-(2-trimethylsilylethoxymethyl)-3H-pyrido[2,3-b]pyrazine-4-carboxamide (PubChem CID 131742370) has the molecular formula C28H36FN5O5Si and a molecular weight of 569.71 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-pyrrol-1-ylphenyl)-2-methoxyethyl]-7-methoxy-2-oxo-1-(2-trimethylsilylethoxymethyl)-3H-pyrido[2,3-b]pyrazine-4-carboxamide.
| Compound Name | N-[1-(3-fluoro-4-pyrrol-1-ylphenyl)-2-methoxyethyl]-7-methoxy-2-oxo-1-(2-trimethylsilylethoxymethyl)-3H-pyrido[2,3-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 131742370 |
| Molecular Formula | C28H36FN5O5Si |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | N-[1-(3-fluoro-4-pyrrol-1-ylphenyl)-2-methoxyethyl]-7-methoxy-2-oxo-1-(2-trimethylsilylethoxymethyl)-3H-pyrido[2,3-b]pyrazine-4-carboxamide |
| SMILES | COCC(NC(=O)N1CC(=O)N(COCC[Si](C)(C)C)c2cc(OC)cnc21)c1ccc(-n2cccc2)c(F)c1 |
| InChI | InChI=1S/C28H36FN5O5Si/c1-37-18-23(20-8-9-24(22(29)14-20)32-10-6-7-11-32)31-28(36)33-17-26(35)34(19-39-12-13-40(3,4)5)25-15-21(38-2)16-30-27(25)33/h6-11,14-16,23H,12-13,17-19H2,1-5H3,(H,31,36) |
| InChIKey | QZLSPEYGDNYOQS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|