C23H46ClFO4Si2 — CID 131742975
(3S,4R,5R)-3-chloro-3-fluoro-4-tri(propan-2-yl)silyloxy-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one (PubChem CID 131742975) has the molecular formula C23H46ClFO4Si2 and a molecular weight of 497.24 g/mol. Its IUPAC name is (3S,4R,5R)-3-chloro-3-fluoro-4-tri(propan-2-yl)silyloxy-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one.
| Compound Name | (3S,4R,5R)-3-chloro-3-fluoro-4-tri(propan-2-yl)silyloxy-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 131742975 |
| Molecular Formula | C23H46ClFO4Si2 |
| Molecular Weight | 497.24 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (3S,4R,5R)-3-chloro-3-fluoro-4-tri(propan-2-yl)silyloxy-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
| SMILES | CC(C)[Si](OC[C@H]1OC(=O)[C@@](F)(Cl)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H46ClFO4Si2/c1-14(2)30(15(3)4,16(5)6)27-13-20-21(23(24,25)22(26)28-20)29-31(17(7)8,18(9)10)19(11)12/h14-21H,13H2,1-12H3/t20-,21-,23-/m1/s1 |
| InChIKey | KQKKJOKDDQQEOB-MQSCRBSSSA-N |
| XLogP | 7.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.24 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|