C5H9Cl2N — CID 131743042
cis-(1S,3R)-2,2-dichloro-N,3-dimethylcyclopropan-1-amine (PubChem CID 131743042) has the molecular formula C5H9Cl2N and a molecular weight of 154.04 g/mol. Its IUPAC name is cis-(1S,3R)-2,2-dichloro-N,3-dimethylcyclopropan-1-amine.
| Compound Name | cis-(1S,3R)-2,2-dichloro-N,3-dimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 131743042 |
| Molecular Formula | C5H9Cl2N |
| Molecular Weight | 154.04 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | cis-(1S,3R)-2,2-dichloro-N,3-dimethylcyclopropan-1-amine |
| SMILES | CN[C@H]1[C@@H](C)C1(Cl)Cl |
| InChI | InChI=1S/C5H9Cl2N/c1-3-4(8-2)5(3,6)7/h3-4,8H,1-2H3/t3-,4+/m1/s1 |
| InChIKey | YOPRJXKUDZVWAF-DMTCNVIQSA-N |
| XLogP | 1.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.04 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|