C25H21N3O5 — CID 131743109
methyl 4-[3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxo-1-(2-pyridin-3-ylethyl)pyrrolidin-2-yl]benzoate (PubChem CID 131743109) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is methyl 4-[3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxo-1-(2-pyridin-3-ylethyl)pyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxo-1-(2-pyridin-3-ylethyl)pyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 131743109 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | methyl 4-[3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxo-1-(2-pyridin-3-ylethyl)pyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3ccncc3)C(=O)C(=O)N2CCc2cccnc2)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-33-25(32)19-6-4-17(5-7-19)21-20(22(29)18-8-12-26-13-9-18)23(30)24(31)28(21)14-10-16-3-2-11-27-15-16/h2-9,11-13,15,21,29H,10,14H2,1H3 |
| InChIKey | XGFYYWNPBWBGLD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|