About 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile
2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile (PubChem CID 131743308) has the molecular formula C15H8Cl2N2O2
and a molecular weight of 319.15 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile |
| PubChem CID | 131743308 |
| Molecular Formula | C15H8Cl2N2O2 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile |
| SMILES | COc1cc(C#N)c(-c2ccc(Cl)c(Cl)c2)c(C#N)c1O |
| InChI | InChI=1S/C15H8Cl2N2O2/c1-21-13-5-9(6-18)14(10(7-19)15(13)20)8-2-3-11(16)12(17)4-8/h2-5,20H,1H3 |
| InChIKey | SSQYDVDYBZQXSK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile?
The IUPAC name of 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile (CID 131743308) is 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile?
The canonical SMILES for 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile is COc1cc(C#N)c(-c2ccc(Cl)c(Cl)c2)c(C#N)c1O.
What is the InChIKey of 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile?
The InChIKey is SSQYDVDYBZQXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl2N2O2/c1-21-13-5-9(6-18)14(10(7-19)15(13)20)8-2-3-11(16)12(17)4-8/h2-5,20H,1H3.
What are the key properties of 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile?
2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile has a molecular weight of 319.15 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-4-hydroxy-5-methoxybenzene-1,3-dicarbonitrile is sourced from PubChem (CID 131743308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).