C19H32N4O6 — CID 131743752
1-O-tert-butyl 2-O-methyl (2S,4R)-4-[[1-(5-hydroxypentyl)triazol-4-yl]methoxy]pyrrolidine-1,2-dicarboxylate (PubChem CID 131743752) has the molecular formula C19H32N4O6 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[[1-(5-hydroxypentyl)triazol-4-yl]methoxy]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[[1-(5-hydroxypentyl)triazol-4-yl]methoxy]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 131743752 |
| Molecular Formula | C19H32N4O6 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[[1-(5-hydroxypentyl)triazol-4-yl]methoxy]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OCc2cn(CCCCCO)nn2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N4O6/c1-19(2,3)29-18(26)23-12-15(10-16(23)17(25)27-4)28-13-14-11-22(21-20-14)8-6-5-7-9-24/h11,15-16,24H,5-10,12-13H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | JKVVTUWEALTFHQ-CVEARBPZSA-N |
| XLogP | 1.51 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|