C18H29N5O4Si — CID 131743847
[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxyiminomethyl)oxolan-2-yl]methanol (PubChem CID 131743847) has the molecular formula C18H29N5O4Si and a molecular weight of 407.55 g/mol. Its IUPAC name is [5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxyiminomethyl)oxolan-2-yl]methanol.
| Compound Name | [5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxyiminomethyl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 131743847 |
| Molecular Formula | C18H29N5O4Si |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxyiminomethyl)oxolan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(n2ccc3c(N)ncnc32)OC1(C=NO)CO |
| InChI | InChI=1S/C18H29N5O4Si/c1-17(2,3)28(4,5)27-13-8-14(26-18(13,10-24)9-22-25)23-7-6-12-15(19)20-11-21-16(12)23/h6-7,9,11,13-14,24-25H,8,10H2,1-5H3,(H2,19,20,21) |
| InChIKey | AJAVOKWBSYTUHC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|