C11H21NO2Si — CID 131743945
[(7aS)-3,3-dimethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]oxy-trimethylsilane (PubChem CID 131743945) has the molecular formula C11H21NO2Si and a molecular weight of 227.38 g/mol. Its IUPAC name is [(7aS)-3,3-dimethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]oxy-trimethylsilane.
| Compound Name | [(7aS)-3,3-dimethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 131743945 |
| Molecular Formula | C11H21NO2Si |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | [(7aS)-3,3-dimethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]oxy-trimethylsilane |
| SMILES | CC1(C)OC[C@@H]2CC=C(O[Si](C)(C)C)N21 |
| InChI | InChI=1S/C11H21NO2Si/c1-11(2)12-9(8-13-11)6-7-10(12)14-15(3,4)5/h7,9H,6,8H2,1-5H3/t9-/m0/s1 |
| InChIKey | ZDWHIJPAWDYAPU-VIFPVBQESA-N |
| XLogP | 2.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|