C18H40O4S2Si — CID 131744072
(2S,3R,4R)-1,1-bis(ethylsulfanyl)-5-tri(propan-2-yl)silyloxypentane-2,3,4-triol (PubChem CID 131744072) has the molecular formula C18H40O4S2Si and a molecular weight of 412.73 g/mol. Its IUPAC name is (2S,3R,4R)-1,1-bis(ethylsulfanyl)-5-tri(propan-2-yl)silyloxypentane-2,3,4-triol.
| Compound Name | (2S,3R,4R)-1,1-bis(ethylsulfanyl)-5-tri(propan-2-yl)silyloxypentane-2,3,4-triol |
|---|---|
| PubChem CID | 131744072 |
| Molecular Formula | C18H40O4S2Si |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2S,3R,4R)-1,1-bis(ethylsulfanyl)-5-tri(propan-2-yl)silyloxypentane-2,3,4-triol |
| SMILES | CCSC(SCC)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H40O4S2Si/c1-9-23-18(24-10-2)17(21)16(20)15(19)11-22-25(12(3)4,13(5)6)14(7)8/h12-21H,9-11H2,1-8H3/t15-,16-,17+/m1/s1 |
| InChIKey | QFSSESHVSUEXCM-ZACQAIPSSA-N |
| XLogP | 4.09 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|