C31H43ClF3N3O4 — CID 131744331
N-[(10-chloroanthracen-9-yl)methyl]octan-1-amine;(2S)-2,6-diaminohexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 131744331) has the molecular formula C31H43ClF3N3O4 and a molecular weight of 614.15 g/mol. Its IUPAC name is N-[(10-chloroanthracen-9-yl)methyl]octan-1-amine;(2S)-2,6-diaminohexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(10-chloroanthracen-9-yl)methyl]octan-1-amine;(2S)-2,6-diaminohexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 131744331 |
| Molecular Formula | C31H43ClF3N3O4 |
| Molecular Weight | 614.15 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | N-[(10-chloroanthracen-9-yl)methyl]octan-1-amine;(2S)-2,6-diaminohexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCNCc1c2ccccc2c(Cl)c2ccccc12.NCCCC[C@H](N)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28ClN.C6H14N2O2.C2HF3O2/c1-2-3-4-5-6-11-16-25-17-22-18-12-7-9-14-20(18)23(24)21-15-10-8-13-19(21)22;7-4-2-1-3-5(8)6(9)10;3-2(4,5)1(6)7/h7-10,12-15,25H,2-6,11,16-17H2,1H3;5H,1-4,7-8H2,(H,9,10);(H,6,7)/t;5-;/m.0./s1 |
| InChIKey | QJXQDIIOXJSNPD-NXAOXGSFSA-N |
| XLogP | 7.26 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.15 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|