C21H25F4N3O2Si — CID 131744457
2-[[6-[5-fluoro-4-methoxy-2-(2,2,2-trifluoroethyl)phenyl]pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 131744457) has the molecular formula C21H25F4N3O2Si and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-[[6-[5-fluoro-4-methoxy-2-(2,2,2-trifluoroethyl)phenyl]pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-[5-fluoro-4-methoxy-2-(2,2,2-trifluoroethyl)phenyl]pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 131744457 |
| Molecular Formula | C21H25F4N3O2Si |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-[[6-[5-fluoro-4-methoxy-2-(2,2,2-trifluoroethyl)phenyl]pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(CC(F)(F)F)c(-c2cc3c(cn2)cnn3COCC[Si](C)(C)C)cc1F |
| InChI | InChI=1S/C21H25F4N3O2Si/c1-29-20-7-14(10-21(23,24)25)16(8-17(20)22)18-9-19-15(11-26-18)12-27-28(19)13-30-5-6-31(2,3)4/h7-9,11-12H,5-6,10,13H2,1-4H3 |
| InChIKey | RTNNAYNQCVPTGV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|