About 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one
2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one (PubChem CID 131744660) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one |
| PubChem CID | 131744660 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one |
| SMILES | CC(C)N1c2ccnc(=O)n2CCC1C |
| InChI | InChI=1S/C11H17N3O/c1-8(2)14-9(3)5-7-13-10(14)4-6-12-11(13)15/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | BKNLXHWIPOFMCC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one?
The IUPAC name of 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one (CID 131744660) is 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one.
What is the SMILES notation for 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one?
The canonical SMILES for 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one is CC(C)N1c2ccnc(=O)n2CCC1C.
What is the InChIKey of 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one?
The InChIKey is BKNLXHWIPOFMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-8(2)14-9(3)5-7-13-10(14)4-6-12-11(13)15/h4,6,8-9H,5,7H2,1-3H3.
What are the key properties of 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one?
2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one has a molecular weight of 207.28 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-propan-2-yl-3,4-dihydro-2H-pyrimido[1,2-c]pyrimidin-6-one is sourced from PubChem (CID 131744660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).