C24H32ClF2N5OSi — CID 131744742
2-[[4-chloro-6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 131744742) has the molecular formula C24H32ClF2N5OSi and a molecular weight of 508.09 g/mol. Its IUPAC name is 2-[[4-chloro-6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-chloro-6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 131744742 |
| Molecular Formula | C24H32ClF2N5OSi |
| Molecular Weight | 508.09 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-[[4-chloro-6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(N3CCN(CC(F)F)CC3)cc2)cc2c(Cl)ncnc21 |
| InChI | InChI=1S/C24H32ClF2N5OSi/c1-34(2,3)13-12-33-17-32-21(14-20-23(25)28-16-29-24(20)32)18-4-6-19(7-5-18)31-10-8-30(9-11-31)15-22(26)27/h4-7,14,16,22H,8-13,15,17H2,1-3H3 |
| InChIKey | AMVKJZRLEPEYEB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.09 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|