C31H34ClFN2O5Si — CID 131745131
(3R,3aR,6R,6aR)-6-[6-chloro-3-fluoro-5-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 131745131) has the molecular formula C31H34ClFN2O5Si and a molecular weight of 597.16 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[6-chloro-3-fluoro-5-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[6-chloro-3-fluoro-5-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 131745131 |
| Molecular Formula | C31H34ClFN2O5Si |
| Molecular Weight | 597.16 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[6-chloro-3-fluoro-5-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | C[Si](C)(C)CCOCn1c(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)c(F)c2nc(-c3ccc(-c4ccccc4)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C31H34ClFN2O5Si/c1-41(2,3)14-13-37-18-35-23-15-22(32)27(21-11-9-20(10-12-21)19-7-5-4-6-8-19)34-28(23)26(33)31(35)40-25-17-39-29-24(36)16-38-30(25)29/h4-12,15,24-25,29-30,36H,13-14,16-18H2,1-3H3/t24-,25-,29-,30-/m1/s1 |
| InChIKey | ZGBAOGKINWWSNN-XSLCZBKOSA-N |
| XLogP | 6.38 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.16 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|