C20H41BO3Si — CID 131745314
tert-butyl-dimethyl-[(E,3S)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-3-yl]oxysilane (PubChem CID 131745314) has the molecular formula C20H41BO3Si and a molecular weight of 368.44 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,3S)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,3S)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 131745314 |
| Molecular Formula | C20H41BO3Si |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | tert-butyl-dimethyl-[(E,3S)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-3-yl]oxysilane |
| SMILES | CCCCC[C@@H](/C=C/B1OC(C)(C)C(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H41BO3Si/c1-11-12-13-14-17(22-25(9,10)18(2,3)4)15-16-21-23-19(5,6)20(7,8)24-21/h15-17H,11-14H2,1-10H3/b16-15+/t17-/m0/s1 |
| InChIKey | UGSDKGSWOAVCBG-IWLLYFRBSA-N |
| XLogP | 6.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|