C16H20BFN2O2 — CID 131745633
4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-methylpyrazole (PubChem CID 131745633) has the molecular formula C16H20BFN2O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-methylpyrazole.
| Compound Name | 4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 131745633 |
| Molecular Formula | C16H20BFN2O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-methylpyrazole |
| SMILES | Cn1cc(-c2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c2)cn1 |
| InChI | InChI=1S/C16H20BFN2O2/c1-15(2)16(3,4)22-17(21-15)13-7-6-11(8-14(13)18)12-9-19-20(5)10-12/h6-10H,1-5H3 |
| InChIKey | NLWZZWKFPVNWQJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|