C20H39BO3Si — CID 131745705
tert-butyl-[(1R)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 131745705) has the molecular formula C20H39BO3Si and a molecular weight of 366.43 g/mol. Its IUPAC name is tert-butyl-[(1R)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 131745705 |
| Molecular Formula | C20H39BO3Si |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | tert-butyl-[(1R)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | CC1(C)CCC(B2OC(C)(C)C(C)(C)O2)=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H39BO3Si/c1-17(2,3)25(10,11)22-16-14-15(12-13-18(16,4)5)21-23-19(6,7)20(8,9)24-21/h14,16H,12-13H2,1-11H3/t16-/m1/s1 |
| InChIKey | RKPFEKQSMAURJE-MRXNPFEDSA-N |
| XLogP | 5.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|