About ethyl trimethylsilyl sulfate
ethyl trimethylsilyl sulfate (PubChem CID 131745806) has the molecular formula C5H14O4SSi
and a molecular weight of 198.32 g/mol. Its IUPAC name is ethyl trimethylsilyl sulfate.
Molecular Properties
| Compound Name | ethyl trimethylsilyl sulfate |
| PubChem CID | 131745806 |
| Molecular Formula | C5H14O4SSi |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | ethyl trimethylsilyl sulfate |
| SMILES | CCOS(=O)(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C5H14O4SSi/c1-5-8-10(6,7)9-11(2,3)4/h5H2,1-4H3 |
| InChIKey | YSDUZWIPUOSUPC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl trimethylsilyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl trimethylsilyl sulfate?
The IUPAC name of ethyl trimethylsilyl sulfate (CID 131745806) is ethyl trimethylsilyl sulfate.
What is the SMILES notation for ethyl trimethylsilyl sulfate?
The canonical SMILES for ethyl trimethylsilyl sulfate is CCOS(=O)(=O)O[Si](C)(C)C.
What is the InChIKey of ethyl trimethylsilyl sulfate?
The InChIKey is YSDUZWIPUOSUPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O4SSi/c1-5-8-10(6,7)9-11(2,3)4/h5H2,1-4H3.
What are the key properties of ethyl trimethylsilyl sulfate?
ethyl trimethylsilyl sulfate has a molecular weight of 198.32 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl trimethylsilyl sulfate is sourced from PubChem (CID 131745806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).