C26H29NO4S — CID 131745829
5-[3-[(2R)-2-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-5-oxopyrrolidin-1-yl]prop-1-ynyl]thiophene-2-carboxylic acid (PubChem CID 131745829) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is 5-[3-[(2R)-2-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-5-oxopyrrolidin-1-yl]prop-1-ynyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(2R)-2-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-5-oxopyrrolidin-1-yl]prop-1-ynyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 131745829 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 5-[3-[(2R)-2-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-5-oxopyrrolidin-1-yl]prop-1-ynyl]thiophene-2-carboxylic acid |
| SMILES | CC(CCCc1ccccc1)[C@@H](O)/C=C/[C@H]1CCC(=O)N1CC#Cc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C26H29NO4S/c1-19(7-5-10-20-8-3-2-4-9-20)23(28)15-12-21-13-17-25(29)27(21)18-6-11-22-14-16-24(32-22)26(30)31/h2-4,8-9,12,14-16,19,21,23,28H,5,7,10,13,17-18H2,1H3,(H,30,31)/b15-12+/t19?,21-,23-/m0/s1 |
| InChIKey | ZCCXWUVQGLSWPS-UXBVXSMZSA-N |
| XLogP | 4.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|