C23H35NO4Si — CID 131746039
(3R,6R,8E,11R)-6-[tert-butyl(dimethyl)silyl]oxy-11-methyl-3-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (PubChem CID 131746039) has the molecular formula C23H35NO4Si and a molecular weight of 417.62 g/mol. Its IUPAC name is (3R,6R,8E,11R)-6-[tert-butyl(dimethyl)silyl]oxy-11-methyl-3-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
| Compound Name | (3R,6R,8E,11R)-6-[tert-butyl(dimethyl)silyl]oxy-11-methyl-3-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 131746039 |
| Molecular Formula | C23H35NO4Si |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (3R,6R,8E,11R)-6-[tert-butyl(dimethyl)silyl]oxy-11-methyl-3-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| SMILES | C[C@@H]1C/C=C/C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N[C@H](c2ccccc2)COC1=O |
| InChI | InChI=1S/C23H35NO4Si/c1-17-12-10-11-15-20(28-29(5,6)23(2,3)4)21(25)24-19(16-27-22(17)26)18-13-8-7-9-14-18/h7-11,13-14,17,19-20H,12,15-16H2,1-6H3,(H,24,25)/b11-10+/t17-,19+,20-/m1/s1 |
| InChIKey | APYWKXFCFAVLDA-BWGVPMLKSA-N |
| XLogP | 4.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|