C18H24ClNSSi — CID 131746096
[5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-diethylsilane (PubChem CID 131746096) has the molecular formula C18H24ClNSSi and a molecular weight of 350.00 g/mol. Its IUPAC name is [5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-diethylsilane.
| Compound Name | [5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-diethylsilane |
|---|---|
| PubChem CID | 131746096 |
| Molecular Formula | C18H24ClNSSi |
| Molecular Weight | 350.00 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-diethylsilane |
| SMILES | CC[SiH](CC)c1cc2c(s1)CCN(Cc1ccccc1Cl)C2 |
| InChI | InChI=1S/C18H24ClNSSi/c1-3-22(4-2)18-11-15-13-20(10-9-17(15)21-18)12-14-7-5-6-8-16(14)19/h5-8,11,22H,3-4,9-10,12-13H2,1-2H3 |
| InChIKey | AIVOCMBMRQQSSP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.00 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|