C23H33F3N2O3SSi — CID 131746111
tert-butyl N-[(1S,5S,6S)-5-(2,3-difluorophenyl)-5-(fluoromethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 131746111) has the molecular formula C23H33F3N2O3SSi and a molecular weight of 502.68 g/mol. Its IUPAC name is tert-butyl N-[(1S,5S,6S)-5-(2,3-difluorophenyl)-5-(fluoromethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[(1S,5S,6S)-5-(2,3-difluorophenyl)-5-(fluoromethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 131746111 |
| Molecular Formula | C23H33F3N2O3SSi |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | tert-butyl N-[(1S,5S,6S)-5-(2,3-difluorophenyl)-5-(fluoromethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(COCC[Si](C)(C)C)C1=N[C@](CF)(c2cccc(F)c2F)[C@@H]2C[C@@H]2S1 |
| InChI | InChI=1S/C23H33F3N2O3SSi/c1-22(2,3)31-21(29)28(14-30-10-11-33(4,5)6)20-27-23(13-24,16-12-18(16)32-20)15-8-7-9-17(25)19(15)26/h7-9,16,18H,10-14H2,1-6H3/t16-,18+,23-/m1/s1 |
| InChIKey | KYFNPZLWXPJENW-WLENULPWSA-N |
| XLogP | 6.17 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|