C40H49NO3Si — CID 131746299
(2S)-2-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpent-4-enamide (PubChem CID 131746299) has the molecular formula C40H49NO3Si and a molecular weight of 619.92 g/mol. Its IUPAC name is (2S)-2-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpent-4-enamide.
| Compound Name | (2S)-2-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpent-4-enamide |
|---|---|
| PubChem CID | 131746299 |
| Molecular Formula | C40H49NO3Si |
| Molecular Weight | 619.92 g/mol |
| Exact Mass | 619.35 |
| IUPAC Name | (2S)-2-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpent-4-enamide |
| SMILES | C=CC[C@@H](C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)N(C)[C@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C40H49NO3Si/c1-7-20-34(39(43)41(6)37(32-21-12-8-13-22-32)38(42)33-23-14-9-15-24-33)29-31(2)30-44-45(40(3,4)5,35-25-16-10-17-26-35)36-27-18-11-19-28-36/h7-19,21-28,31,34,37-38,42H,1,20,29-30H2,2-6H3/t31-,34+,37-,38-/m1/s1 |
| InChIKey | VDAXFKHILCUSNM-DNVDRYHXSA-N |
| XLogP | 7.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.92 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|