C39H41B2N3O4 — CID 131746321
2-(4-phenylphenyl)-4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 131746321) has the molecular formula C39H41B2N3O4 and a molecular weight of 637.40 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(4-phenylphenyl)-4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 131746321 |
| Molecular Formula | C39H41B2N3O4 |
| Molecular Weight | 637.40 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | 2-(4-phenylphenyl)-4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C39H41B2N3O4/c1-36(2)37(3,4)46-40(45-36)31-22-18-29(19-23-31)34-42-33(28-16-14-27(15-17-28)26-12-10-9-11-13-26)43-35(44-34)30-20-24-32(25-21-30)41-47-38(5,6)39(7,8)48-41/h9-25H,1-8H3 |
| InChIKey | ZOLVYJFCVYWBST-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.40 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|