C46H40BN3O2 — CID 131746323
2-[3-(7,7-dimethylbenzo[c]fluoren-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 131746323) has the molecular formula C46H40BN3O2 and a molecular weight of 677.66 g/mol. Its IUPAC name is 2-[3-(7,7-dimethylbenzo[c]fluoren-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(7,7-dimethylbenzo[c]fluoren-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 131746323 |
| Molecular Formula | C46H40BN3O2 |
| Molecular Weight | 677.66 g/mol |
| Exact Mass | 677.32 |
| IUPAC Name | 2-[3-(7,7-dimethylbenzo[c]fluoren-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2c1cc(-c1cc(B3OC(C)(C)C(C)(C)O3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c1)c1ccccc21 |
| InChI | InChI=1S/C46H40BN3O2/c1-44(2)38-24-16-15-23-36(38)40-35-22-14-13-21-34(35)37(28-39(40)44)31-25-32(27-33(26-31)47-51-45(3,4)46(5,6)52-47)43-49-41(29-17-9-7-10-18-29)48-42(50-43)30-19-11-8-12-20-30/h7-28H,1-6H3 |
| InChIKey | HRJAFBGUJUSXCV-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.66 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|