C30H41BrN8O5 — CID 131746330
tert-butyl N-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]-3-(2-piperazin-2-yloxyethoxy)phenyl]carbamate (PubChem CID 131746330) has the molecular formula C30H41BrN8O5 and a molecular weight of 673.61 g/mol. Its IUPAC name is tert-butyl N-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]-3-(2-piperazin-2-yloxyethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]-3-(2-piperazin-2-yloxyethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 131746330 |
| Molecular Formula | C30H41BrN8O5 |
| Molecular Weight | 673.61 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | tert-butyl N-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]-3-(2-piperazin-2-yloxyethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(N2CCN(C3COC3)CC2)c(OCCOC2CNCCN2)c1)c1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C30H41BrN8O5/c1-30(2,3)44-29(40)39(28-27-34-8-9-38(27)18-25(31)35-28)21-4-5-23(37-12-10-36(11-13-37)22-19-41-20-22)24(16-21)42-14-15-43-26-17-32-6-7-33-26/h4-5,8-9,16,18,22,26,32-33H,6-7,10-15,17,19-20H2,1-3H3 |
| InChIKey | NRHFBCVCXXBANZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|