C38H37ClN2O4Si — CID 131746466
methyl 2-[6-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobuten-1-yl]-2-(3-chlorophenyl)-4-oxoquinazolin-3-yl]acetate (PubChem CID 131746466) has the molecular formula C38H37ClN2O4Si and a molecular weight of 649.26 g/mol. Its IUPAC name is methyl 2-[6-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobuten-1-yl]-2-(3-chlorophenyl)-4-oxoquinazolin-3-yl]acetate.
| Compound Name | methyl 2-[6-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobuten-1-yl]-2-(3-chlorophenyl)-4-oxoquinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 131746466 |
| Molecular Formula | C38H37ClN2O4Si |
| Molecular Weight | 649.26 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | methyl 2-[6-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobuten-1-yl]-2-(3-chlorophenyl)-4-oxoquinazolin-3-yl]acetate |
| SMILES | COC(=O)Cn1c(-c2cccc(Cl)c2)nc2ccc(C3=CC(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C3)cc2c1=O |
| InChI | InChI=1S/C38H37ClN2O4Si/c1-38(2,3)46(31-14-7-5-8-15-31,32-16-9-6-10-17-32)45-25-26-20-29(21-26)27-18-19-34-33(23-27)37(43)41(24-35(42)44-4)36(40-34)28-12-11-13-30(39)22-28/h5-20,22-23,26H,21,24-25H2,1-4H3 |
| InChIKey | FCZAHYUFDGVLRL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.26 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|