About (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate
(4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate (PubChem CID 131746537) has the molecular formula C11H16F2N2O3
and a molecular weight of 262.26 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| PubChem CID | 131746537 |
| Molecular Formula | C11H16F2N2O3 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| SMILES | CN(C(=O)OC1CCC(F)(F)CC1)[C@H]1CNC1=O |
| InChI | InChI=1S/C11H16F2N2O3/c1-15(8-6-14-9(8)16)10(17)18-7-2-4-11(12,13)5-3-7/h7-8H,2-6H2,1H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | YCZZFQNNDBNMSQ-QMMMGPOBSA-N |
| XLogP | 1.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The IUPAC name of (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate (CID 131746537) is (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate.
What is the SMILES notation for (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The canonical SMILES for (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate is CN(C(=O)OC1CCC(F)(F)CC1)[C@H]1CNC1=O.
What is the InChIKey of (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The InChIKey is YCZZFQNNDBNMSQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H16F2N2O3/c1-15(8-6-14-9(8)16)10(17)18-7-2-4-11(12,13)5-3-7/h7-8H,2-6H2,1H3,(H,14,16)/t8-/m0/s1.
What are the key properties of (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate?
(4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate has a molecular weight of 262.26 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate is sourced from PubChem (CID 131746537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).