About 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate
4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate (PubChem CID 131746538) has the molecular formula C13H14F2NO3-
and a molecular weight of 270.25 g/mol. Its IUPAC name is 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate.
Molecular Properties
| Compound Name | 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate |
| PubChem CID | 131746538 |
| Molecular Formula | C13H14F2NO3- |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate |
| SMILES | Cc1c(C2CCC(F)(F)CC2)ccn(C(=O)[O-])c1=O |
| InChI | InChI=1S/C13H15F2NO3/c1-8-10(4-7-16(11(8)17)12(18)19)9-2-5-13(14,15)6-3-9/h4,7,9H,2-3,5-6H2,1H3,(H,18,19)/p-1 |
| InChIKey | QAPHMDSTKSCSHK-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate?
The IUPAC name of 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate (CID 131746538) is 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate.
What is the SMILES notation for 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate?
The canonical SMILES for 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate is Cc1c(C2CCC(F)(F)CC2)ccn(C(=O)[O-])c1=O.
What is the InChIKey of 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate?
The InChIKey is QAPHMDSTKSCSHK-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H15F2NO3/c1-8-10(4-7-16(11(8)17)12(18)19)9-2-5-13(14,15)6-3-9/h4,7,9H,2-3,5-6H2,1H3,(H,18,19)/p-1.
What are the key properties of 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate?
4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate has a molecular weight of 270.25 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluorocyclohexyl)-3-methyl-2-oxopyridine-1-carboxylate is sourced from PubChem (CID 131746538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).