About 2-nitrobut-2-enoate
2-nitrobut-2-enoate (PubChem CID 131746597) has the molecular formula C4H4NO4-
and a molecular weight of 130.08 g/mol. Its IUPAC name is 2-nitrobut-2-enoate.
Molecular Properties
| Compound Name | 2-nitrobut-2-enoate |
| PubChem CID | 131746597 |
| Molecular Formula | C4H4NO4- |
| Molecular Weight | 130.08 g/mol |
| Exact Mass | 130.01 |
| IUPAC Name | 2-nitrobut-2-enoate |
| SMILES | CC=C(C(=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H5NO4/c1-2-3(4(6)7)5(8)9/h2H,1H3,(H,6,7)/p-1 |
| InChIKey | WTERXQXUTRDDKY-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.08 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobut-2-enoate?
The IUPAC name of 2-nitrobut-2-enoate (CID 131746597) is 2-nitrobut-2-enoate.
What is the SMILES notation for 2-nitrobut-2-enoate?
The canonical SMILES for 2-nitrobut-2-enoate is CC=C(C(=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-nitrobut-2-enoate?
The InChIKey is WTERXQXUTRDDKY-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H5NO4/c1-2-3(4(6)7)5(8)9/h2H,1H3,(H,6,7)/p-1.
What are the key properties of 2-nitrobut-2-enoate?
2-nitrobut-2-enoate has a molecular weight of 130.08 g/mol, XLogP of -1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobut-2-enoate is sourced from PubChem (CID 131746597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).