C27H37NO4Si — CID 131746615
(4R)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylbutanoyl]-1,3-oxazolidin-2-one (PubChem CID 131746615) has the molecular formula C27H37NO4Si and a molecular weight of 467.68 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylbutanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylbutanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 131746615 |
| Molecular Formula | C27H37NO4Si |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (4R)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylbutanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@](C)(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H37NO4Si/c1-20(24(29)28-23(19-31-25(28)30)18-21-14-10-8-11-15-21)27(5,22-16-12-9-13-17-22)32-33(6,7)26(2,3)4/h8-17,20,23H,18-19H2,1-7H3/t20-,23-,27-/m1/s1 |
| InChIKey | BPTRUGLBACUNPL-SZEHJLNQSA-N |
| XLogP | 6.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|