C21H22F2N2OSi — CID 131747557
2-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]ethynyl-trimethylsilane (PubChem CID 131747557) has the molecular formula C21H22F2N2OSi and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 131747557 |
| Molecular Formula | C21H22F2N2OSi |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(OCc2c(F)cccc2F)c2nc(C)c(C#C[Si](C)(C)C)n2c1 |
| InChI | InChI=1S/C21H22F2N2OSi/c1-14-11-20(26-13-16-17(22)7-6-8-18(16)23)21-24-15(2)19(25(21)12-14)9-10-27(3,4)5/h6-8,11-12H,13H2,1-5H3 |
| InChIKey | WUKCTHOCFDDHLP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|