C16H26N2O4SSi — CID 131747589
2-[3-[4-(2-trimethylsilylethoxymethoxymethyl)-1,3-thiazol-2-yl]-1,2-oxazol-5-yl]propan-2-ol (PubChem CID 131747589) has the molecular formula C16H26N2O4SSi and a molecular weight of 370.55 g/mol. Its IUPAC name is 2-[3-[4-(2-trimethylsilylethoxymethoxymethyl)-1,3-thiazol-2-yl]-1,2-oxazol-5-yl]propan-2-ol.
| Compound Name | 2-[3-[4-(2-trimethylsilylethoxymethoxymethyl)-1,3-thiazol-2-yl]-1,2-oxazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 131747589 |
| Molecular Formula | C16H26N2O4SSi |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[3-[4-(2-trimethylsilylethoxymethoxymethyl)-1,3-thiazol-2-yl]-1,2-oxazol-5-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(-c2nc(COCOCC[Si](C)(C)C)cs2)no1 |
| InChI | InChI=1S/C16H26N2O4SSi/c1-16(2,19)14-8-13(18-22-14)15-17-12(10-23-15)9-21-11-20-6-7-24(3,4)5/h8,10,19H,6-7,9,11H2,1-5H3 |
| InChIKey | YPZVATZSDDPWPH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|