C22H25BF4N2 — CID 131747832
1-(9H-fluoren-2-yl)-3-hexylimidazol-3-ium tetrafluoroborate (PubChem CID 131747832) has the molecular formula C22H25BF4N2 and a molecular weight of 404.26 g/mol. Its IUPAC name is 1-(9H-fluoren-2-yl)-3-hexylimidazol-3-ium tetrafluoroborate.
| Compound Name | 1-(9H-fluoren-2-yl)-3-hexylimidazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 131747832 |
| Molecular Formula | C22H25BF4N2 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-(9H-fluoren-2-yl)-3-hexylimidazol-3-ium tetrafluoroborate |
| SMILES | CCCCCC[n+]1ccn(-c2ccc3c(c2)Cc2ccccc2-3)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C22H25N2.BF4/c1-2-3-4-7-12-23-13-14-24(17-23)20-10-11-22-19(16-20)15-18-8-5-6-9-21(18)22;2-1(3,4)5/h5-6,8-11,13-14,16-17H,2-4,7,12,15H2,1H3;/q+1;-1 |
| InChIKey | AEBFXOSKGMQVRM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|