About 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride
6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride (PubChem CID 131747875) has the molecular formula C8H13Cl3N4
and a molecular weight of 271.58 g/mol. Its IUPAC name is 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride.
Molecular Properties
| Compound Name | 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride |
| PubChem CID | 131747875 |
| Molecular Formula | C8H13Cl3N4 |
| Molecular Weight | 271.58 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride |
| SMILES | Cc1cn2cc(N)nc2c(C)n1.Cl.Cl.Cl |
| InChI | InChI=1S/C8H10N4.3ClH/c1-5-3-12-4-7(9)11-8(12)6(2)10-5;;;/h3-4H,9H2,1-2H3;3*1H |
| InChIKey | ARRIUUTVEGHTPL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride?
The IUPAC name of 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride (CID 131747875) is 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride.
What is the SMILES notation for 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride?
The canonical SMILES for 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride is Cc1cn2cc(N)nc2c(C)n1.Cl.Cl.Cl.
What is the InChIKey of 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride?
The InChIKey is ARRIUUTVEGHTPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4.3ClH/c1-5-3-12-4-7(9)11-8(12)6(2)10-5;;;/h3-4H,9H2,1-2H3;3*1H.
What are the key properties of 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride?
6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride has a molecular weight of 271.58 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethylimidazo[1,2-a]pyrazin-2-amine;trihydrochloride is sourced from PubChem (CID 131747875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).