C17H22BNO4 — CID 131748418
7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-4-one (PubChem CID 131748418) has the molecular formula C17H22BNO4 and a molecular weight of 315.18 g/mol. Its IUPAC name is 7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-4-one.
| Compound Name | 7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 131748418 |
| Molecular Formula | C17H22BNO4 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-4-one |
| SMILES | COc1cc2[nH]c(C)cc(=O)c2cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H22BNO4/c1-10-7-14(20)11-8-12(15(21-6)9-13(11)19-10)18-22-16(2,3)17(4,5)23-18/h7-9H,1-6H3,(H,19,20) |
| InChIKey | SIAHCGIFTDTFOR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|