C24H32BN5O3 — CID 131748422
[7-methoxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-3-yl]boronic acid (PubChem CID 131748422) has the molecular formula C24H32BN5O3 and a molecular weight of 449.36 g/mol. Its IUPAC name is [7-methoxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-3-yl]boronic acid.
| Compound Name | [7-methoxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-3-yl]boronic acid |
|---|---|
| PubChem CID | 131748422 |
| Molecular Formula | C24H32BN5O3 |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | [7-methoxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-3-yl]boronic acid |
| SMILES | COc1cc2ncc(B(O)O)cc2cc1-c1ccc(N(C)C2CC(C)(C)NC(C)(C)C2)nn1 |
| InChI | InChI=1S/C24H32BN5O3/c1-23(2)12-17(13-24(3,4)29-23)30(5)22-8-7-19(27-28-22)18-10-15-9-16(25(31)32)14-26-20(15)11-21(18)33-6/h7-11,14,17,29,31-32H,12-13H2,1-6H3 |
| InChIKey | PFWWJPODQJTYNX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|