About tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate
tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate (PubChem CID 131748743) has the molecular formula C12H19F2NO3
and a molecular weight of 263.28 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate |
| PubChem CID | 131748743 |
| Molecular Formula | C12H19F2NO3 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate |
| SMILES | COC=CC1CC(F)(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19F2NO3/c1-11(2,3)18-10(16)15-8-12(13,14)7-9(15)5-6-17-4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | UVQMMZADICBDLY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate (CID 131748743) is tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate is COC=CC1CC(F)(F)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate?
The InChIKey is UVQMMZADICBDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2NO3/c1-11(2,3)18-10(16)15-8-12(13,14)7-9(15)5-6-17-4/h5-6,9H,7-8H2,1-4H3.
What are the key properties of tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate?
tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate has a molecular weight of 263.28 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4,4-difluoro-2-(2-methoxyethenyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 131748743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).