C33H29BN4O2 — CID 131748811
9-[4-phenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]carbazole (PubChem CID 131748811) has the molecular formula C33H29BN4O2 and a molecular weight of 524.43 g/mol. Its IUPAC name is 9-[4-phenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-phenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 131748811 |
| Molecular Formula | C33H29BN4O2 |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 9-[4-phenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]carbazole |
| SMILES | CC1(C)OB(c2cccc(-c3nc(-c4ccccc4)nc(-n4c5ccccc5c5ccccc54)n3)c2)OC1(C)C |
| InChI | InChI=1S/C33H29BN4O2/c1-32(2)33(3,4)40-34(39-32)24-16-12-15-23(21-24)30-35-29(22-13-6-5-7-14-22)36-31(37-30)38-27-19-10-8-17-25(27)26-18-9-11-20-28(26)38/h5-21H,1-4H3 |
| InChIKey | CJETVXBWYDUNDJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|