About [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane
[5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane (PubChem CID 131748828) has the molecular formula C20H23F6NOSi
and a molecular weight of 435.48 g/mol. Its IUPAC name is [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane |
| PubChem CID | 131748828 |
| Molecular Formula | C20H23F6NOSi |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(-c2c(C(F)(F)F)cccc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H23F6NOSi/c1-18(2,3)29(4,5)28-12-14-10-9-13(11-27-14)17-15(19(21,22)23)7-6-8-16(17)20(24,25)26/h6-11H,12H2,1-5H3 |
| InChIKey | QFYPGWYEPXDWQO-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane?
The IUPAC name of [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane (CID 131748828) is [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane?
The canonical SMILES for [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane is CC(C)(C)[Si](C)(C)OCc1ccc(-c2c(C(F)(F)F)cccc2C(F)(F)F)cn1.
What is the InChIKey of [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane?
The InChIKey is QFYPGWYEPXDWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F6NOSi/c1-18(2,3)29(4,5)28-12-14-10-9-13(11-27-14)17-15(19(21,22)23)7-6-8-16(17)20(24,25)26/h6-11H,12H2,1-5H3.
What are the key properties of [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane?
[5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane has a molecular weight of 435.48 g/mol, XLogP of 7.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[2,6-bis(trifluoromethyl)phenyl]-2-pyridinyl]methoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 131748828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).