C22H29Cl2N7O2 — CID 131749224
tert-butyl (3R)-3-[[2-[[amino-(3,4-dichloroanilino)methylidene]amino]-6-methylpyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 131749224) has the molecular formula C22H29Cl2N7O2 and a molecular weight of 494.43 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-[[amino-(3,4-dichloroanilino)methylidene]amino]-6-methylpyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-[[amino-(3,4-dichloroanilino)methylidene]amino]-6-methylpyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131749224 |
| Molecular Formula | C22H29Cl2N7O2 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | tert-butyl (3R)-3-[[2-[[amino-(3,4-dichloroanilino)methylidene]amino]-6-methylpyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | Cc1cc(N[C@@H]2CCCN(C(=O)OC(C)(C)C)C2)nc(N=C(N)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C22H29Cl2N7O2/c1-13-10-18(27-15-6-5-9-31(12-15)21(32)33-22(2,3)4)29-20(26-13)30-19(25)28-14-7-8-16(23)17(24)11-14/h7-8,10-11,15H,5-6,9,12H2,1-4H3,(H4,25,26,27,28,29,30)/t15-/m1/s1 |
| InChIKey | MBZLSNAOSNDHEB-OAHLLOKOSA-N |
| XLogP | 4.96 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|