C42H56O3SSi — CID 131749539
[(2Z,6Z,10E)-9-(benzenesulfonyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]-tert-butyl-diphenylsilane (PubChem CID 131749539) has the molecular formula C42H56O3SSi and a molecular weight of 669.06 g/mol. Its IUPAC name is [(2Z,6Z,10E)-9-(benzenesulfonyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2Z,6Z,10E)-9-(benzenesulfonyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 131749539 |
| Molecular Formula | C42H56O3SSi |
| Molecular Weight | 669.06 g/mol |
| Exact Mass | 668.37 |
| IUPAC Name | [(2Z,6Z,10E)-9-(benzenesulfonyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)=CCC/C(C)=C/C(C/C(C)=C\CC/C(C)=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C42H56O3SSi/c1-34(2)20-18-22-36(4)32-39(46(43,44)38-24-12-9-13-25-38)33-37(5)23-19-21-35(3)30-31-45-47(42(6,7)8,40-26-14-10-15-27-40)41-28-16-11-17-29-41/h9-17,20,23-30,32,39H,18-19,21-22,31,33H2,1-8H3/b35-30-,36-32+,37-23- |
| InChIKey | WYXVLAPZZHXYRB-SMCYFWNPSA-N |
| XLogP | 10.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.06 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|