C13H16BNO5 — CID 131749653
(3R)-3-(butanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 131749653) has the molecular formula C13H16BNO5 and a molecular weight of 277.08 g/mol. Its IUPAC name is (3R)-3-(butanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(butanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 131749653 |
| Molecular Formula | C13H16BNO5 |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (3R)-3-(butanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCCC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C13H16BNO5/c1-2-4-11(16)15-10-7-8-5-3-6-9(13(17)18)12(8)20-14(10)19/h3,5-6,10,19H,2,4,7H2,1H3,(H,15,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | SQLFYXSUNURCGX-JTQLQIEISA-N |
| XLogP | 0.62 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|