C14H16BNO6 — CID 131749657
(3R)-2-hydroxy-3-(4-oxopentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 131749657) has the molecular formula C14H16BNO6 and a molecular weight of 305.10 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-(4-oxopentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-(4-oxopentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 131749657 |
| Molecular Formula | C14H16BNO6 |
| Molecular Weight | 305.10 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (3R)-2-hydroxy-3-(4-oxopentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(=O)CCC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C14H16BNO6/c1-8(17)5-6-12(18)16-11-7-9-3-2-4-10(14(19)20)13(9)22-15(11)21/h2-4,11,21H,5-7H2,1H3,(H,16,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | QMDICSQBTJSBGE-NSHDSACASA-N |
| XLogP | 0.19 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.10 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|