C30H52O10Si — CID 131749831
2-[(1S,3R,4S,5R,7R,9S,11R)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-[methoxy-di(propan-2-yl)silyl]oxy-8-oxo-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 131749831) has the molecular formula C30H52O10Si and a molecular weight of 600.82 g/mol. Its IUPAC name is 2-[(1S,3R,4S,5R,7R,9S,11R)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-[methoxy-di(propan-2-yl)silyl]oxy-8-oxo-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(1S,3R,4S,5R,7R,9S,11R)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-[methoxy-di(propan-2-yl)silyl]oxy-8-oxo-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 131749831 |
| Molecular Formula | C30H52O10Si |
| Molecular Weight | 600.82 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 2-[(1S,3R,4S,5R,7R,9S,11R)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-[methoxy-di(propan-2-yl)silyl]oxy-8-oxo-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CO[Si](O[C@@H]1[C@@H]2O[C@H]3CC[C@H](CCOC(=O)C(C)(C)C)O[C@@H]3C(=O)[C@@H]2O[C@@H]1CC1COC(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H52O10Si/c1-17(2)41(33-10,18(3)4)40-25-22(15-20-16-35-30(8,9)39-20)38-26-23(31)24-21(37-27(25)26)12-11-19(36-24)13-14-34-28(32)29(5,6)7/h17-22,24-27H,11-16H2,1-10H3/t19-,20?,21+,22-,24+,25+,26+,27+/m1/s1 |
| InChIKey | NXTNYQURELWUBF-PJEAWZNBSA-N |
| XLogP | 4.45 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|